C10H11F2N3 — CID 135267007
(5R)-6,6-difluoro-N,N-dimethyl-8,9-diazatricyclo[5.3.0.02,5]deca-1(7),3,9-trien-10-amine (PubChem CID 135267007) has the molecular formula C10H11F2N3 and a molecular weight of 211.21 g/mol. Its IUPAC name is (5R)-6,6-difluoro-N,N-dimethyl-8,9-diazatricyclo[5.3.0.02,5]deca-1(7),3,9-trien-10-amine.
| Compound Name | (5R)-6,6-difluoro-N,N-dimethyl-8,9-diazatricyclo[5.3.0.02,5]deca-1(7),3,9-trien-10-amine |
|---|---|
| PubChem CID | 135267007 |
| Molecular Formula | C10H11F2N3 |
| Molecular Weight | 211.21 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | (5R)-6,6-difluoro-N,N-dimethyl-8,9-diazatricyclo[5.3.0.02,5]deca-1(7),3,9-trien-10-amine |
| SMILES | CN(C)c1n[nH]c2c1C1C=C[C@H]1C2(F)F |
| InChI | InChI=1S/C10H11F2N3/c1-15(2)9-7-5-3-4-6(5)10(11,12)8(7)13-14-9/h3-6H,1-2H3,(H,13,14)/t5?,6-/m1/s1 |
| InChIKey | LLEDTNFYSLGUAB-PRJDIBJQSA-N |
| XLogP | 1.85 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.21 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|