C11H16N4 — CID 135271027
4-N-butyl-5-ethynyl-6-methylpyrimidine-2,4-diamine (PubChem CID 135271027) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is 4-N-butyl-5-ethynyl-6-methylpyrimidine-2,4-diamine.
| Compound Name | 4-N-butyl-5-ethynyl-6-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 135271027 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 4-N-butyl-5-ethynyl-6-methylpyrimidine-2,4-diamine |
| SMILES | C#Cc1c(C)nc(N)nc1NCCCC |
| InChI | InChI=1S/C11H16N4/c1-4-6-7-13-10-9(5-2)8(3)14-11(12)15-10/h2H,4,6-7H2,1,3H3,(H3,12,13,14,15) |
| InChIKey | IDFGHWVAVWVEOJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|