C24H50O3 — CID 135274570
4-ethyl-4-[2-(4-ethyl-2,6-dimethylheptan-4-yl)peroxyethoxy]-2,6-dimethylheptane (PubChem CID 135274570) has the molecular formula C24H50O3 and a molecular weight of 386.66 g/mol. Its IUPAC name is 4-ethyl-4-[2-(4-ethyl-2,6-dimethylheptan-4-yl)peroxyethoxy]-2,6-dimethylheptane.
| Compound Name | 4-ethyl-4-[2-(4-ethyl-2,6-dimethylheptan-4-yl)peroxyethoxy]-2,6-dimethylheptane |
|---|---|
| PubChem CID | 135274570 |
| Molecular Formula | C24H50O3 |
| Molecular Weight | 386.66 g/mol |
| Exact Mass | 386.38 |
| IUPAC Name | 4-ethyl-4-[2-(4-ethyl-2,6-dimethylheptan-4-yl)peroxyethoxy]-2,6-dimethylheptane |
| SMILES | CCC(CC(C)C)(CC(C)C)OCCOOC(CC)(CC(C)C)CC(C)C |
| InChI | InChI=1S/C24H50O3/c1-11-23(15-19(3)4,16-20(5)6)25-13-14-26-27-24(12-2,17-21(7)8)18-22(9)10/h19-22H,11-18H2,1-10H3 |
| InChIKey | BQYTZZBXZUOQBU-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.66 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|