About 4-ethyl-4-[2-(4-ethyl-2,6-dimethylheptan-4-yl)peroxyethoxy]-2,6-dimethylheptane
4-ethyl-4-[2-(4-ethyl-2,6-dimethylheptan-4-yl)peroxyethoxy]-2,6-dimethylheptane (PubChem CID 135274570) has the molecular formula C24H50O3
and a molecular weight of 386.66 g/mol. Its IUPAC name is 4-ethyl-4-[2-(4-ethyl-2,6-dimethylheptan-4-yl)peroxyethoxy]-2,6-dimethylheptane.
Molecular Properties
| Compound Name | 4-ethyl-4-[2-(4-ethyl-2,6-dimethylheptan-4-yl)peroxyethoxy]-2,6-dimethylheptane |
| PubChem CID | 135274570 |
| Molecular Formula | C24H50O3 |
| Molecular Weight | 386.66 g/mol |
| Exact Mass | 386.38 |
| IUPAC Name | 4-ethyl-4-[2-(4-ethyl-2,6-dimethylheptan-4-yl)peroxyethoxy]-2,6-dimethylheptane |
| SMILES | CCC(CC(C)C)(CC(C)C)OCCOOC(CC)(CC(C)C)CC(C)C |
| InChI | InChI=1S/C24H50O3/c1-11-23(15-19(3)4,16-20(5)6)25-13-14-26-27-24(12-2,17-21(7)8)18-22(9)10/h19-22H,11-18H2,1-10H3 |
| InChIKey | BQYTZZBXZUOQBU-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.66 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-4-[2-(4-ethyl-2,6-dimethylheptan-4-yl)peroxyethoxy]-2,6-dimethylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-4-[2-(4-ethyl-2,6-dimethylheptan-4-yl)peroxyethoxy]-2,6-dimethylheptane?
The IUPAC name of 4-ethyl-4-[2-(4-ethyl-2,6-dimethylheptan-4-yl)peroxyethoxy]-2,6-dimethylheptane (CID 135274570) is 4-ethyl-4-[2-(4-ethyl-2,6-dimethylheptan-4-yl)peroxyethoxy]-2,6-dimethylheptane.
What is the SMILES notation for 4-ethyl-4-[2-(4-ethyl-2,6-dimethylheptan-4-yl)peroxyethoxy]-2,6-dimethylheptane?
The canonical SMILES for 4-ethyl-4-[2-(4-ethyl-2,6-dimethylheptan-4-yl)peroxyethoxy]-2,6-dimethylheptane is CCC(CC(C)C)(CC(C)C)OCCOOC(CC)(CC(C)C)CC(C)C.
What is the InChIKey of 4-ethyl-4-[2-(4-ethyl-2,6-dimethylheptan-4-yl)peroxyethoxy]-2,6-dimethylheptane?
The InChIKey is BQYTZZBXZUOQBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H50O3/c1-11-23(15-19(3)4,16-20(5)6)25-13-14-26-27-24(12-2,17-21(7)8)18-22(9)10/h19-22H,11-18H2,1-10H3.
What are the key properties of 4-ethyl-4-[2-(4-ethyl-2,6-dimethylheptan-4-yl)peroxyethoxy]-2,6-dimethylheptane?
4-ethyl-4-[2-(4-ethyl-2,6-dimethylheptan-4-yl)peroxyethoxy]-2,6-dimethylheptane has a molecular weight of 386.66 g/mol, XLogP of 7.43, 16 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-4-[2-(4-ethyl-2,6-dimethylheptan-4-yl)peroxyethoxy]-2,6-dimethylheptane is sourced from PubChem (CID 135274570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).