C26H54O3Si — CID 139950714
bis[[2,6-dimethyl-4-(2-methylpropyl)heptan-4-yl]oxy]-oxosilane (PubChem CID 139950714) has the molecular formula C26H54O3Si and a molecular weight of 442.80 g/mol. Its IUPAC name is bis[[2,6-dimethyl-4-(2-methylpropyl)heptan-4-yl]oxy]-oxosilane.
| Compound Name | bis[[2,6-dimethyl-4-(2-methylpropyl)heptan-4-yl]oxy]-oxosilane |
|---|---|
| PubChem CID | 139950714 |
| Molecular Formula | C26H54O3Si |
| Molecular Weight | 442.80 g/mol |
| Exact Mass | 442.38 |
| IUPAC Name | bis[[2,6-dimethyl-4-(2-methylpropyl)heptan-4-yl]oxy]-oxosilane |
| SMILES | CC(C)CC(CC(C)C)(CC(C)C)O[Si](=O)OC(CC(C)C)(CC(C)C)CC(C)C |
| InChI | InChI=1S/C26H54O3Si/c1-19(2)13-25(14-20(3)4,15-21(5)6)28-30(27)29-26(16-22(7)8,17-23(9)10)18-24(11)12/h19-24H,13-18H2,1-12H3 |
| InChIKey | XHTDDWFRVBVLBY-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.80 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|