C20H15ClF3NO — CID 135276093
5-(2-chloro-3,5-difluorophenyl)-1-ethyl-6-(4-fluorophenyl)-3-methylpyridin-2-one (PubChem CID 135276093) has the molecular formula C20H15ClF3NO and a molecular weight of 377.79 g/mol. Its IUPAC name is 5-(2-chloro-3,5-difluorophenyl)-1-ethyl-6-(4-fluorophenyl)-3-methylpyridin-2-one.
| Compound Name | 5-(2-chloro-3,5-difluorophenyl)-1-ethyl-6-(4-fluorophenyl)-3-methylpyridin-2-one |
|---|---|
| PubChem CID | 135276093 |
| Molecular Formula | C20H15ClF3NO |
| Molecular Weight | 377.79 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 5-(2-chloro-3,5-difluorophenyl)-1-ethyl-6-(4-fluorophenyl)-3-methylpyridin-2-one |
| SMILES | CCn1c(-c2ccc(F)cc2)c(-c2cc(F)cc(F)c2Cl)cc(C)c1=O |
| InChI | InChI=1S/C20H15ClF3NO/c1-3-25-19(12-4-6-13(22)7-5-12)16(8-11(2)20(25)26)15-9-14(23)10-17(24)18(15)21/h4-10H,3H2,1-2H3 |
| InChIKey | LCDXLFDUYDZIHR-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.79 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|