C18H24N6O — CID 135276168
5-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]-N-propan-2-ylpentanamide (PubChem CID 135276168) has the molecular formula C18H24N6O and a molecular weight of 340.43 g/mol. Its IUPAC name is 5-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]-N-propan-2-ylpentanamide.
| Compound Name | 5-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]-N-propan-2-ylpentanamide |
|---|---|
| PubChem CID | 135276168 |
| Molecular Formula | C18H24N6O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 5-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]-N-propan-2-ylpentanamide |
| SMILES | Cc1nnc2c(NCCCCC(=O)NC(C)C)nc3ccccc3n12 |
| InChI | InChI=1S/C18H24N6O/c1-12(2)20-16(25)10-6-7-11-19-17-18-23-22-13(3)24(18)15-9-5-4-8-14(15)21-17/h4-5,8-9,12H,6-7,10-11H2,1-3H3,(H,19,21)(H,20,25) |
| InChIKey | JJECOZSEDLNTON-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|