C19H26N6O — CID 135276169
6-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]-N-propan-2-ylhexanamide (PubChem CID 135276169) has the molecular formula C19H26N6O and a molecular weight of 354.46 g/mol. Its IUPAC name is 6-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]-N-propan-2-ylhexanamide.
| Compound Name | 6-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]-N-propan-2-ylhexanamide |
|---|---|
| PubChem CID | 135276169 |
| Molecular Formula | C19H26N6O |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 6-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]-N-propan-2-ylhexanamide |
| SMILES | Cc1nnc2c(NCCCCCC(=O)NC(C)C)nc3ccccc3n12 |
| InChI | InChI=1S/C19H26N6O/c1-13(2)21-17(26)11-5-4-8-12-20-18-19-24-23-14(3)25(19)16-10-7-6-9-15(16)22-18/h6-7,9-10,13H,4-5,8,11-12H2,1-3H3,(H,20,22)(H,21,26) |
| InChIKey | VUBBRUNIHSIGJW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|