C24H30N4O6 — CID 135279148
tert-butyl N-[3-[3-[3-(2,4-dioxopyrimidin-1-yl)quinolin-5-yl]oxypropoxy]propyl]carbamate (PubChem CID 135279148) has the molecular formula C24H30N4O6 and a molecular weight of 470.53 g/mol. Its IUPAC name is tert-butyl N-[3-[3-[3-(2,4-dioxopyrimidin-1-yl)quinolin-5-yl]oxypropoxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-[3-(2,4-dioxopyrimidin-1-yl)quinolin-5-yl]oxypropoxy]propyl]carbamate |
|---|---|
| PubChem CID | 135279148 |
| Molecular Formula | C24H30N4O6 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | tert-butyl N-[3-[3-[3-(2,4-dioxopyrimidin-1-yl)quinolin-5-yl]oxypropoxy]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCOCCCOc1cccc2ncc(-n3ccc(=O)[nH]c3=O)cc12 |
| InChI | InChI=1S/C24H30N4O6/c1-24(2,3)34-23(31)25-10-5-12-32-13-6-14-33-20-8-4-7-19-18(20)15-17(16-26-19)28-11-9-21(29)27-22(28)30/h4,7-9,11,15-16H,5-6,10,12-14H2,1-3H3,(H,25,31)(H,27,29,30) |
| InChIKey | WORXXISVTHTMIE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 124.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|