About 1-(2-cyclopropylethyl)-1,2-dimethylhydrazine
1-(2-cyclopropylethyl)-1,2-dimethylhydrazine (PubChem CID 135280697) has the molecular formula C7H16N2
and a molecular weight of 128.22 g/mol. Its IUPAC name is 1-(2-cyclopropylethyl)-1,2-dimethylhydrazine.
Molecular Properties
| Compound Name | 1-(2-cyclopropylethyl)-1,2-dimethylhydrazine |
| PubChem CID | 135280697 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | 1-(2-cyclopropylethyl)-1,2-dimethylhydrazine |
| SMILES | CNN(C)CCC1CC1 |
| InChI | InChI=1S/C7H16N2/c1-8-9(2)6-5-7-3-4-7/h7-8H,3-6H2,1-2H3 |
| InChIKey | SBXQCOZIHGEDLY-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-cyclopropylethyl)-1,2-dimethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-cyclopropylethyl)-1,2-dimethylhydrazine?
The IUPAC name of 1-(2-cyclopropylethyl)-1,2-dimethylhydrazine (CID 135280697) is 1-(2-cyclopropylethyl)-1,2-dimethylhydrazine.
What is the SMILES notation for 1-(2-cyclopropylethyl)-1,2-dimethylhydrazine?
The canonical SMILES for 1-(2-cyclopropylethyl)-1,2-dimethylhydrazine is CNN(C)CCC1CC1.
What is the InChIKey of 1-(2-cyclopropylethyl)-1,2-dimethylhydrazine?
The InChIKey is SBXQCOZIHGEDLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2/c1-8-9(2)6-5-7-3-4-7/h7-8H,3-6H2,1-2H3.
What are the key properties of 1-(2-cyclopropylethyl)-1,2-dimethylhydrazine?
1-(2-cyclopropylethyl)-1,2-dimethylhydrazine has a molecular weight of 128.22 g/mol, XLogP of 0.85, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-cyclopropylethyl)-1,2-dimethylhydrazine is sourced from PubChem (CID 135280697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).