C19H24F3N3O — CID 135282204
2,4-dimethyl-1-[[4-methyl-6-[2-(trifluoromethyl)-4-pyridinyl]-3-pyridinyl]oxy]pentan-1-amine (PubChem CID 135282204) has the molecular formula C19H24F3N3O and a molecular weight of 367.42 g/mol. Its IUPAC name is 2,4-dimethyl-1-[[4-methyl-6-[2-(trifluoromethyl)-4-pyridinyl]-3-pyridinyl]oxy]pentan-1-amine.
| Compound Name | 2,4-dimethyl-1-[[4-methyl-6-[2-(trifluoromethyl)-4-pyridinyl]-3-pyridinyl]oxy]pentan-1-amine |
|---|---|
| PubChem CID | 135282204 |
| Molecular Formula | C19H24F3N3O |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 2,4-dimethyl-1-[[4-methyl-6-[2-(trifluoromethyl)-4-pyridinyl]-3-pyridinyl]oxy]pentan-1-amine |
| SMILES | Cc1cc(-c2ccnc(C(F)(F)F)c2)ncc1OC(N)C(C)CC(C)C |
| InChI | InChI=1S/C19H24F3N3O/c1-11(2)7-13(4)18(23)26-16-10-25-15(8-12(16)3)14-5-6-24-17(9-14)19(20,21)22/h5-6,8-11,13,18H,7,23H2,1-4H3 |
| InChIKey | HBIWYVMTRCMGFR-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|