C15H21F3N6O2 — CID 135286428
[carbamimidoyl-[5-[4-(dimethylamino)piperidin-1-yl]-2-pyridinyl]amino] 2,2,2-trifluoroacetate (PubChem CID 135286428) has the molecular formula C15H21F3N6O2 and a molecular weight of 374.37 g/mol. Its IUPAC name is [carbamimidoyl-[5-[4-(dimethylamino)piperidin-1-yl]-2-pyridinyl]amino] 2,2,2-trifluoroacetate.
| Compound Name | [carbamimidoyl-[5-[4-(dimethylamino)piperidin-1-yl]-2-pyridinyl]amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 135286428 |
| Molecular Formula | C15H21F3N6O2 |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | [carbamimidoyl-[5-[4-(dimethylamino)piperidin-1-yl]-2-pyridinyl]amino] 2,2,2-trifluoroacetate |
| SMILES | [H]/N=C(\N)N(OC(=O)C(F)(F)F)c1ccc(N2CCC(N(C)C)CC2)cn1 |
| InChI | InChI=1S/C15H21F3N6O2/c1-22(2)10-5-7-23(8-6-10)11-3-4-12(21-9-11)24(14(19)20)26-13(25)15(16,17)18/h3-4,9-10H,5-8H2,1-2H3,(H3,19,20) |
| InChIKey | DNXPBYSPOUFPCE-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|