C15H11ClF3IN4S — CID 135289905
2-(6-chloro-3-ethylsulfanyl-2-pyridinyl)-4-iodo-3-methyl-6-(trifluoromethyl)imidazo[4,5-c]pyridine (PubChem CID 135289905) has the molecular formula C15H11ClF3IN4S and a molecular weight of 498.70 g/mol. Its IUPAC name is 2-(6-chloro-3-ethylsulfanyl-2-pyridinyl)-4-iodo-3-methyl-6-(trifluoromethyl)imidazo[4,5-c]pyridine.
| Compound Name | 2-(6-chloro-3-ethylsulfanyl-2-pyridinyl)-4-iodo-3-methyl-6-(trifluoromethyl)imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 135289905 |
| Molecular Formula | C15H11ClF3IN4S |
| Molecular Weight | 498.70 g/mol |
| Exact Mass | 497.94 |
| IUPAC Name | 2-(6-chloro-3-ethylsulfanyl-2-pyridinyl)-4-iodo-3-methyl-6-(trifluoromethyl)imidazo[4,5-c]pyridine |
| SMILES | CCSc1ccc(Cl)nc1-c1nc2cc(C(F)(F)F)nc(I)c2n1C |
| InChI | InChI=1S/C15H11ClF3IN4S/c1-3-25-8-4-5-10(16)23-11(8)14-21-7-6-9(15(17,18)19)22-13(20)12(7)24(14)2/h4-6H,3H2,1-2H3 |
| InChIKey | KPPOCJLGPZRWHH-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.70 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|