C16H12ClF2N3O2S — CID 126574535
6-(6-chloro-3-ethylsulfanyl-2-pyridinyl)-2,2-difluoro-7-methyl-[1,3]dioxolo[4,5-f]benzimidazole (PubChem CID 126574535) has the molecular formula C16H12ClF2N3O2S and a molecular weight of 383.81 g/mol. Its IUPAC name is 6-(6-chloro-3-ethylsulfanyl-2-pyridinyl)-2,2-difluoro-7-methyl-[1,3]dioxolo[4,5-f]benzimidazole.
| Compound Name | 6-(6-chloro-3-ethylsulfanyl-2-pyridinyl)-2,2-difluoro-7-methyl-[1,3]dioxolo[4,5-f]benzimidazole |
|---|---|
| PubChem CID | 126574535 |
| Molecular Formula | C16H12ClF2N3O2S |
| Molecular Weight | 383.81 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | 6-(6-chloro-3-ethylsulfanyl-2-pyridinyl)-2,2-difluoro-7-methyl-[1,3]dioxolo[4,5-f]benzimidazole |
| SMILES | CCSc1ccc(Cl)nc1-c1nc2cc3c(cc2n1C)OC(F)(F)O3 |
| InChI | InChI=1S/C16H12ClF2N3O2S/c1-3-25-12-4-5-13(17)21-14(12)15-20-8-6-10-11(7-9(8)22(15)2)24-16(18,19)23-10/h4-7H,3H2,1-2H3 |
| InChIKey | PJGSTZTXIOQYJR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.81 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|