C25H21F5N4O3S — CID 166928442
2-[5-ethylsulfinyl-2-[3-(1-fluorocyclopropyl)phenyl]-1-methylimidazol-4-yl]-6,6,7,7-tetrafluoro-3-methyl-[1,4]dioxino[2,3-f]benzimidazole (PubChem CID 166928442) has the molecular formula C25H21F5N4O3S and a molecular weight of 552.53 g/mol. Its IUPAC name is 2-[5-ethylsulfinyl-2-[3-(1-fluorocyclopropyl)phenyl]-1-methylimidazol-4-yl]-6,6,7,7-tetrafluoro-3-methyl-[1,4]dioxino[2,3-f]benzimidazole.
| Compound Name | 2-[5-ethylsulfinyl-2-[3-(1-fluorocyclopropyl)phenyl]-1-methylimidazol-4-yl]-6,6,7,7-tetrafluoro-3-methyl-[1,4]dioxino[2,3-f]benzimidazole |
|---|---|
| PubChem CID | 166928442 |
| Molecular Formula | C25H21F5N4O3S |
| Molecular Weight | 552.53 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | 2-[5-ethylsulfinyl-2-[3-(1-fluorocyclopropyl)phenyl]-1-methylimidazol-4-yl]-6,6,7,7-tetrafluoro-3-methyl-[1,4]dioxino[2,3-f]benzimidazole |
| SMILES | CCS(=O)c1c(-c2nc3cc4c(cc3n2C)OC(F)(F)C(F)(F)O4)nc(-c2cccc(C3(F)CC3)c2)n1C |
| InChI | InChI=1S/C25H21F5N4O3S/c1-4-38(35)22-19(32-20(34(22)3)13-6-5-7-14(10-13)23(26)8-9-23)21-31-15-11-17-18(12-16(15)33(21)2)37-25(29,30)24(27,28)36-17/h5-7,10-12H,4,8-9H2,1-3H3 |
| InChIKey | RDLQTYDQMNQNNM-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 71.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.53 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|