C11H7BrF4N2O2 — CID 20675417
2-bromo-3-ethyl-6,6,7,7-tetrafluoro-[1,4]dioxino[2,3-f]benzimidazole (PubChem CID 20675417) has the molecular formula C11H7BrF4N2O2 and a molecular weight of 355.09 g/mol. Its IUPAC name is 2-bromo-3-ethyl-6,6,7,7-tetrafluoro-[1,4]dioxino[2,3-f]benzimidazole.
| Compound Name | 2-bromo-3-ethyl-6,6,7,7-tetrafluoro-[1,4]dioxino[2,3-f]benzimidazole |
|---|---|
| PubChem CID | 20675417 |
| Molecular Formula | C11H7BrF4N2O2 |
| Molecular Weight | 355.09 g/mol |
| Exact Mass | 353.96 |
| IUPAC Name | 2-bromo-3-ethyl-6,6,7,7-tetrafluoro-[1,4]dioxino[2,3-f]benzimidazole |
| SMILES | CCn1c(Br)nc2cc3c(cc21)OC(F)(F)C(F)(F)O3 |
| InChI | InChI=1S/C11H7BrF4N2O2/c1-2-18-6-4-8-7(3-5(6)17-9(18)12)19-10(13,14)11(15,16)20-8/h3-4H,2H2,1H3 |
| InChIKey | WKPRZCRIEKXMKB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.09 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|