C14H5F4N3O4S2 — CID 54357745
6,6,7,7-tetrafluoro-3-thiophen-2-ylsulfonyl-[1,4]dioxino[2,3-f]benzimidazole-2-carbonitrile (PubChem CID 54357745) has the molecular formula C14H5F4N3O4S2 and a molecular weight of 419.34 g/mol. Its IUPAC name is 6,6,7,7-tetrafluoro-3-thiophen-2-ylsulfonyl-[1,4]dioxino[2,3-f]benzimidazole-2-carbonitrile.
| Compound Name | 6,6,7,7-tetrafluoro-3-thiophen-2-ylsulfonyl-[1,4]dioxino[2,3-f]benzimidazole-2-carbonitrile |
|---|---|
| PubChem CID | 54357745 |
| Molecular Formula | C14H5F4N3O4S2 |
| Molecular Weight | 419.34 g/mol |
| Exact Mass | 418.97 |
| IUPAC Name | 6,6,7,7-tetrafluoro-3-thiophen-2-ylsulfonyl-[1,4]dioxino[2,3-f]benzimidazole-2-carbonitrile |
| SMILES | N#Cc1nc2cc3c(cc2n1S(=O)(=O)c1cccs1)OC(F)(F)C(F)(F)O3 |
| InChI | InChI=1S/C14H5F4N3O4S2/c15-13(16)14(17,18)25-10-5-8-7(4-9(10)24-13)20-11(6-19)21(8)27(22,23)12-2-1-3-26-12/h1-5H |
| InChIKey | UKHRWHZEABJZRP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 94.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.34 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|