C20H28N2 — CID 135294936
(1Z,3E,5Z)-3-methyl-1-(4-methylidenecyclohexa-1,5-dien-1-yl)-7-piperidin-4-ylhepta-1,3,5-trien-1-amine (PubChem CID 135294936) has the molecular formula C20H28N2 and a molecular weight of 296.46 g/mol. Its IUPAC name is (1Z,3E,5Z)-3-methyl-1-(4-methylidenecyclohexa-1,5-dien-1-yl)-7-piperidin-4-ylhepta-1,3,5-trien-1-amine.
| Compound Name | (1Z,3E,5Z)-3-methyl-1-(4-methylidenecyclohexa-1,5-dien-1-yl)-7-piperidin-4-ylhepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 135294936 |
| Molecular Formula | C20H28N2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | (1Z,3E,5Z)-3-methyl-1-(4-methylidenecyclohexa-1,5-dien-1-yl)-7-piperidin-4-ylhepta-1,3,5-trien-1-amine |
| SMILES | C=C1C=CC(/C(N)=C/C(C)=C/C=C\CC2CCNCC2)=CC1 |
| InChI | InChI=1S/C20H28N2/c1-16-7-9-19(10-8-16)20(21)15-17(2)5-3-4-6-18-11-13-22-14-12-18/h3-5,7,9-10,15,18,22H,1,6,8,11-14,21H2,2H3/b4-3-,17-5+,20-15- |
| InChIKey | DWVNESPDDWYCDG-DUXMTKGFSA-N |
| XLogP | 4.16 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|