C17H15FN4O3S — CID 135298585
N'-(2-fluorophenyl)sulfonyl-3-(3-methylpyrazol-1-yl)benzohydrazide (PubChem CID 135298585) has the molecular formula C17H15FN4O3S and a molecular weight of 374.40 g/mol. Its IUPAC name is N'-(2-fluorophenyl)sulfonyl-3-(3-methylpyrazol-1-yl)benzohydrazide.
| Compound Name | N'-(2-fluorophenyl)sulfonyl-3-(3-methylpyrazol-1-yl)benzohydrazide |
|---|---|
| PubChem CID | 135298585 |
| Molecular Formula | C17H15FN4O3S |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | N'-(2-fluorophenyl)sulfonyl-3-(3-methylpyrazol-1-yl)benzohydrazide |
| SMILES | Cc1ccn(-c2cccc(C(=O)NNS(=O)(=O)c3ccccc3F)c2)n1 |
| InChI | InChI=1S/C17H15FN4O3S/c1-12-9-10-22(20-12)14-6-4-5-13(11-14)17(23)19-21-26(24,25)16-8-3-2-7-15(16)18/h2-11,21H,1H3,(H,19,23) |
| InChIKey | DNVVOKHMOKZZST-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|