C33H44N2O3 — CID 135302356
(E,10R,13S)-N-[2-(1H-indol-2-yl)ethoxy]-10,13-dimethyl-17-(2-methyl-1,3-dioxolan-2-yl)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-imine (PubChem CID 135302356) has the molecular formula C33H44N2O3 and a molecular weight of 516.73 g/mol. Its IUPAC name is (E,10R,13S)-N-[2-(1H-indol-2-yl)ethoxy]-10,13-dimethyl-17-(2-methyl-1,3-dioxolan-2-yl)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-imine.
| Compound Name | (E,10R,13S)-N-[2-(1H-indol-2-yl)ethoxy]-10,13-dimethyl-17-(2-methyl-1,3-dioxolan-2-yl)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-imine |
|---|---|
| PubChem CID | 135302356 |
| Molecular Formula | C33H44N2O3 |
| Molecular Weight | 516.73 g/mol |
| Exact Mass | 516.34 |
| IUPAC Name | (E,10R,13S)-N-[2-(1H-indol-2-yl)ethoxy]-10,13-dimethyl-17-(2-methyl-1,3-dioxolan-2-yl)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-imine |
| SMILES | CC1(C2CCC3C4CCC5=C/C(=N/OCCc6cc7ccccc7[nH]6)CC[C@]5(C)C4CC[C@@]32C)OCCO1 |
| InChI | InChI=1S/C33H44N2O3/c1-31-15-12-25(35-38-17-14-24-20-22-6-4-5-7-29(22)34-24)21-23(31)8-9-26-27-10-11-30(33(3)36-18-19-37-33)32(27,2)16-13-28(26)31/h4-7,20-21,26-28,30,34H,8-19H2,1-3H3/b35-25+/t26?,27?,28?,30?,31-,32-/m0/s1 |
| InChIKey | JJNQBEYVEOLEPD-OWBDHWJMSA-N |
| XLogP | 7.43 |
| TPSA | 55.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.73 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|