C36H35N3O3 — CID 135302448
N-[[3-[(E)-3-[4-(4-methoxyphenyl)piperazin-1-yl]-3-oxoprop-1-enyl]phenyl]-diphenylmethyl]prop-2-enamide (PubChem CID 135302448) has the molecular formula C36H35N3O3 and a molecular weight of 557.69 g/mol. Its IUPAC name is N-[[3-[(E)-3-[4-(4-methoxyphenyl)piperazin-1-yl]-3-oxoprop-1-enyl]phenyl]-diphenylmethyl]prop-2-enamide.
| Compound Name | N-[[3-[(E)-3-[4-(4-methoxyphenyl)piperazin-1-yl]-3-oxoprop-1-enyl]phenyl]-diphenylmethyl]prop-2-enamide |
|---|---|
| PubChem CID | 135302448 |
| Molecular Formula | C36H35N3O3 |
| Molecular Weight | 557.69 g/mol |
| Exact Mass | 557.27 |
| IUPAC Name | N-[[3-[(E)-3-[4-(4-methoxyphenyl)piperazin-1-yl]-3-oxoprop-1-enyl]phenyl]-diphenylmethyl]prop-2-enamide |
| SMILES | C=CC(=O)NC(c1ccccc1)(c1ccccc1)c1cccc(/C=C/C(=O)N2CCN(c3ccc(OC)cc3)CC2)c1 |
| InChI | InChI=1S/C36H35N3O3/c1-3-34(40)37-36(29-12-6-4-7-13-29,30-14-8-5-9-15-30)31-16-10-11-28(27-31)17-22-35(41)39-25-23-38(24-26-39)32-18-20-33(42-2)21-19-32/h3-22,27H,1,23-26H2,2H3,(H,37,40)/b22-17+ |
| InChIKey | FLLOJVZZPWDSFE-OQKWZONESA-N |
| XLogP | 5.65 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.69 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|