C17H32N2O7 — CID 135302835
2-[2-[2-(1-hydrazinyl-2-methyl-1-oxopropan-2-yl)oxyethoxy]ethoxy]ethyl 5-methyl-4-oxohexanoate (PubChem CID 135302835) has the molecular formula C17H32N2O7 and a molecular weight of 376.45 g/mol. Its IUPAC name is 2-[2-[2-(1-hydrazinyl-2-methyl-1-oxopropan-2-yl)oxyethoxy]ethoxy]ethyl 5-methyl-4-oxohexanoate.
| Compound Name | 2-[2-[2-(1-hydrazinyl-2-methyl-1-oxopropan-2-yl)oxyethoxy]ethoxy]ethyl 5-methyl-4-oxohexanoate |
|---|---|
| PubChem CID | 135302835 |
| Molecular Formula | C17H32N2O7 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 2-[2-[2-(1-hydrazinyl-2-methyl-1-oxopropan-2-yl)oxyethoxy]ethoxy]ethyl 5-methyl-4-oxohexanoate |
| SMILES | CC(C)C(=O)CCC(=O)OCCOCCOCCOC(C)(C)C(=O)NN |
| InChI | InChI=1S/C17H32N2O7/c1-13(2)14(20)5-6-15(21)25-11-9-23-7-8-24-10-12-26-17(3,4)16(22)19-18/h13H,5-12,18H2,1-4H3,(H,19,22) |
| InChIKey | QVXWYMMHHSRHRU-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 126.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|