C17H22BrN3O — CID 135304299
2-[(E)-3-(5-bromo-4-methylbenzimidazol-1-yl)-2-methylprop-1-enyl]piperidin-3-ol (PubChem CID 135304299) has the molecular formula C17H22BrN3O and a molecular weight of 364.29 g/mol. Its IUPAC name is 2-[(E)-3-(5-bromo-4-methylbenzimidazol-1-yl)-2-methylprop-1-enyl]piperidin-3-ol.
| Compound Name | 2-[(E)-3-(5-bromo-4-methylbenzimidazol-1-yl)-2-methylprop-1-enyl]piperidin-3-ol |
|---|---|
| PubChem CID | 135304299 |
| Molecular Formula | C17H22BrN3O |
| Molecular Weight | 364.29 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 2-[(E)-3-(5-bromo-4-methylbenzimidazol-1-yl)-2-methylprop-1-enyl]piperidin-3-ol |
| SMILES | C/C(=C\C1NCCCC1O)Cn1cnc2c(C)c(Br)ccc21 |
| InChI | InChI=1S/C17H22BrN3O/c1-11(8-14-16(22)4-3-7-19-14)9-21-10-20-17-12(2)13(18)5-6-15(17)21/h5-6,8,10,14,16,19,22H,3-4,7,9H2,1-2H3/b11-8+ |
| InChIKey | PVJVTEMHISZYOW-DHZHZOJOSA-N |
| XLogP | 3.17 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|