C15H19Cl4N3O — CID 153284028
(2R,3S)-2-[(E)-3-(5,6-dichlorobenzimidazol-1-yl)prop-1-enyl]piperidin-3-ol;dihydrochloride (PubChem CID 153284028) has the molecular formula C15H19Cl4N3O and a molecular weight of 399.15 g/mol. Its IUPAC name is (2R,3S)-2-[(E)-3-(5,6-dichlorobenzimidazol-1-yl)prop-1-enyl]piperidin-3-ol;dihydrochloride.
| Compound Name | (2R,3S)-2-[(E)-3-(5,6-dichlorobenzimidazol-1-yl)prop-1-enyl]piperidin-3-ol;dihydrochloride |
|---|---|
| PubChem CID | 153284028 |
| Molecular Formula | C15H19Cl4N3O |
| Molecular Weight | 399.15 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | (2R,3S)-2-[(E)-3-(5,6-dichlorobenzimidazol-1-yl)prop-1-enyl]piperidin-3-ol;dihydrochloride |
| SMILES | Cl.Cl.O[C@H]1CCCN[C@@H]1/C=C/Cn1cnc2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C15H17Cl2N3O.2ClH/c16-10-7-13-14(8-11(10)17)20(9-19-13)6-2-3-12-15(21)4-1-5-18-12;;/h2-3,7-9,12,15,18,21H,1,4-6H2;2*1H/b3-2+;;/t12-,15+;;/m1../s1 |
| InChIKey | OAXCHTWEBPGZJI-DVHRCRDBSA-N |
| XLogP | 3.86 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.15 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|