C16H20Cl2N4O2 — CID 126730847
(2R,3S)-2-[(2Z)-3-(5,6-dichlorobenzimidazol-1-yl)-2-methoxyiminopropyl]piperidin-3-ol (PubChem CID 126730847) has the molecular formula C16H20Cl2N4O2 and a molecular weight of 371.27 g/mol. Its IUPAC name is (2R,3S)-2-[(2Z)-3-(5,6-dichlorobenzimidazol-1-yl)-2-methoxyiminopropyl]piperidin-3-ol.
| Compound Name | (2R,3S)-2-[(2Z)-3-(5,6-dichlorobenzimidazol-1-yl)-2-methoxyiminopropyl]piperidin-3-ol |
|---|---|
| PubChem CID | 126730847 |
| Molecular Formula | C16H20Cl2N4O2 |
| Molecular Weight | 371.27 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | (2R,3S)-2-[(2Z)-3-(5,6-dichlorobenzimidazol-1-yl)-2-methoxyiminopropyl]piperidin-3-ol |
| SMILES | CO/N=C(/C[C@H]1NCCC[C@@H]1O)Cn1cnc2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C16H20Cl2N4O2/c1-24-21-10(5-14-16(23)3-2-4-19-14)8-22-9-20-13-6-11(17)12(18)7-15(13)22/h6-7,9,14,16,19,23H,2-5,8H2,1H3/b21-10-/t14-,16+/m1/s1 |
| InChIKey | NAUDZBJMEJVRAJ-QINWUOBPSA-N |
| XLogP | 2.85 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|