C14H15Cl2N3 — CID 153284016
5,6-dichloro-1-[(E)-3-[(2S)-pyrrolidin-2-yl]prop-2-enyl]benzimidazole (PubChem CID 153284016) has the molecular formula C14H15Cl2N3 and a molecular weight of 296.20 g/mol. Its IUPAC name is 5,6-dichloro-1-[(E)-3-[(2S)-pyrrolidin-2-yl]prop-2-enyl]benzimidazole.
| Compound Name | 5,6-dichloro-1-[(E)-3-[(2S)-pyrrolidin-2-yl]prop-2-enyl]benzimidazole |
|---|---|
| PubChem CID | 153284016 |
| Molecular Formula | C14H15Cl2N3 |
| Molecular Weight | 296.20 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 5,6-dichloro-1-[(E)-3-[(2S)-pyrrolidin-2-yl]prop-2-enyl]benzimidazole |
| SMILES | Clc1cc2ncn(C/C=C/[C@@H]3CCCN3)c2cc1Cl |
| InChI | InChI=1S/C14H15Cl2N3/c15-11-7-13-14(8-12(11)16)19(9-18-13)6-2-4-10-3-1-5-17-10/h2,4,7-10,17H,1,3,5-6H2/b4-2+/t10-/m0/s1 |
| InChIKey | FLPQSXFABKWSJF-YWNRKNDBSA-N |
| XLogP | 3.65 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.20 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|