C18H21BClN5O3 — CID 89101792
CID 89101792 (PubChem CID 89101792) has the molecular formula C18H21BClN5O3 and a molecular weight of 401.66 g/mol.
| Compound Name | CID 89101792 |
|---|---|
| PubChem CID | 89101792 |
| Molecular Formula | C18H21BClN5O3 |
| Molecular Weight | 401.66 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | — |
| SMILES | [B]c1cc2ncn(C/C(C[C@H]3NCCC[C@@H]3O)=N\NC(C)=O)c(=O)c2cc1Cl |
| InChI | InChI=1S/C18H21BClN5O3/c1-10(26)23-24-11(5-16-17(27)3-2-4-21-16)8-25-9-22-15-7-13(19)14(20)6-12(15)18(25)28/h6-7,9,16-17,21,27H,2-5,8H2,1H3,(H,23,26)/b24-11-/t16-,17+/m1/s1 |
| InChIKey | JKQHJGBHCTWPTE-ARGLMKIGSA-N |
| XLogP | -0.16 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.66 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|