C16H17BClN5O2 — CID 89101793
CID 89101793 (PubChem CID 89101793) has the molecular formula C16H17BClN5O2 and a molecular weight of 357.61 g/mol.
| Compound Name | CID 89101793 |
|---|---|
| PubChem CID | 89101793 |
| Molecular Formula | C16H17BClN5O2 |
| Molecular Weight | 357.61 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | — |
| SMILES | [B]c1cc2ncn(CC3(C[C@H]4NCCC[C@@H]4O)N=N3)c(=O)c2cc1Cl |
| InChI | InChI=1S/C16H17BClN5O2/c17-10-5-12-9(4-11(10)18)15(25)23(8-20-12)7-16(21-22-16)6-13-14(24)2-1-3-19-13/h4-5,8,13-14,19,24H,1-3,6-7H2/t13-,14+/m1/s1 |
| InChIKey | GFYLVXMDRFNNNH-KGLIPLIRSA-N |
| XLogP | 0.51 |
| TPSA | 91.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.61 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|