About 1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylic acid;methane
1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylic acid;methane (PubChem CID 157173027) has the molecular formula C18H24N2O3
and a molecular weight of 316.40 g/mol. Its IUPAC name is 1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylic acid;methane.
Molecular Properties
| Compound Name | 1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylic acid;methane |
| PubChem CID | 157173027 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylic acid;methane |
| SMILES | C.O=C(O)c1cn(C/C=C/[C@H]2NCCC[C@@H]2O)c2ccccc12 |
| InChI | InChI=1S/C17H20N2O3.CH4/c20-16-8-3-9-18-14(16)6-4-10-19-11-13(17(21)22)12-5-1-2-7-15(12)19;/h1-2,4-7,11,14,16,18,20H,3,8-10H2,(H,21,22);1H4/b6-4+;/t14-,16+;/m1./s1 |
| InChIKey | ANROSRGZPYZOHJ-YMVBODGJSA-N |
| XLogP | 2.64 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylic acid;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylic acid;methane?
The IUPAC name of 1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylic acid;methane (CID 157173027) is 1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylic acid;methane.
What is the SMILES notation for 1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylic acid;methane?
The canonical SMILES for 1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylic acid;methane is C.O=C(O)c1cn(C/C=C/[C@H]2NCCC[C@@H]2O)c2ccccc12.
What is the InChIKey of 1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylic acid;methane?
The InChIKey is ANROSRGZPYZOHJ-YMVBODGJSA-N. The full InChI is InChI=1S/C17H20N2O3.CH4/c20-16-8-3-9-18-14(16)6-4-10-19-11-13(17(21)22)12-5-1-2-7-15(12)19;/h1-2,4-7,11,14,16,18,20H,3,8-10H2,(H,21,22);1H4/b6-4+;/t14-,16+;/m1./s1.
What are the key properties of 1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylic acid;methane?
1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylic acid;methane has a molecular weight of 316.40 g/mol, XLogP of 2.64, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylic acid;methane is sourced from PubChem (CID 157173027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).