C18H23BrN2O3 — CID 160891982
5-bromo-1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylic acid;methane (PubChem CID 160891982) has the molecular formula C18H23BrN2O3 and a molecular weight of 395.30 g/mol. Its IUPAC name is 5-bromo-1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylic acid;methane.
| Compound Name | 5-bromo-1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylic acid;methane |
|---|---|
| PubChem CID | 160891982 |
| Molecular Formula | C18H23BrN2O3 |
| Molecular Weight | 395.30 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 5-bromo-1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylic acid;methane |
| SMILES | C.O=C(O)c1cn(C/C=C/[C@H]2NCCC[C@@H]2O)c2ccc(Br)cc12 |
| InChI | InChI=1S/C17H19BrN2O3.CH4/c18-11-5-6-15-12(9-11)13(17(22)23)10-20(15)8-2-3-14-16(21)4-1-7-19-14;/h2-3,5-6,9-10,14,16,19,21H,1,4,7-8H2,(H,22,23);1H4/b3-2+;/t14-,16+;/m1./s1 |
| InChIKey | SOJVSZFCYJRBDE-DCLHXJQPSA-N |
| XLogP | 3.41 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|