C18H23N7 — CID 135305238
4-[2-[[2-amino-6-[3-(methylamino)azetidin-1-yl]pyrimidin-4-yl]methylamino]ethyl]benzonitrile (PubChem CID 135305238) has the molecular formula C18H23N7 and a molecular weight of 337.43 g/mol. Its IUPAC name is 4-[2-[[2-amino-6-[3-(methylamino)azetidin-1-yl]pyrimidin-4-yl]methylamino]ethyl]benzonitrile.
| Compound Name | 4-[2-[[2-amino-6-[3-(methylamino)azetidin-1-yl]pyrimidin-4-yl]methylamino]ethyl]benzonitrile |
|---|---|
| PubChem CID | 135305238 |
| Molecular Formula | C18H23N7 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 4-[2-[[2-amino-6-[3-(methylamino)azetidin-1-yl]pyrimidin-4-yl]methylamino]ethyl]benzonitrile |
| SMILES | CNC1CN(c2cc(CNCCc3ccc(C#N)cc3)nc(N)n2)C1 |
| InChI | InChI=1S/C18H23N7/c1-21-16-11-25(12-16)17-8-15(23-18(20)24-17)10-22-7-6-13-2-4-14(9-19)5-3-13/h2-5,8,16,21-22H,6-7,10-12H2,1H3,(H2,20,23,24) |
| InChIKey | VMMXMNAAASRKNY-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 102.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|