C17H24N6O — CID 135305239
2-[[2-amino-6-[3-(methylamino)azetidin-1-yl]pyrimidin-4-yl]methylamino]-1-phenylethanol (PubChem CID 135305239) has the molecular formula C17H24N6O and a molecular weight of 328.42 g/mol. Its IUPAC name is 2-[[2-amino-6-[3-(methylamino)azetidin-1-yl]pyrimidin-4-yl]methylamino]-1-phenylethanol.
| Compound Name | 2-[[2-amino-6-[3-(methylamino)azetidin-1-yl]pyrimidin-4-yl]methylamino]-1-phenylethanol |
|---|---|
| PubChem CID | 135305239 |
| Molecular Formula | C17H24N6O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 2-[[2-amino-6-[3-(methylamino)azetidin-1-yl]pyrimidin-4-yl]methylamino]-1-phenylethanol |
| SMILES | CNC1CN(c2cc(CNCC(O)c3ccccc3)nc(N)n2)C1 |
| InChI | InChI=1S/C17H24N6O/c1-19-14-10-23(11-14)16-7-13(21-17(18)22-16)8-20-9-15(24)12-5-3-2-4-6-12/h2-7,14-15,19-20,24H,8-11H2,1H3,(H2,18,21,22) |
| InChIKey | OLMZBXIIUHBAHR-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |