C14H24N2O2 — CID 135307784
[4-[bis(prop-2-enyl)amino]-4-methylcyclohexyl]carbamic acid (PubChem CID 135307784) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is [4-[bis(prop-2-enyl)amino]-4-methylcyclohexyl]carbamic acid.
| Compound Name | [4-[bis(prop-2-enyl)amino]-4-methylcyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 135307784 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | [4-[bis(prop-2-enyl)amino]-4-methylcyclohexyl]carbamic acid |
| SMILES | C=CCN(CC=C)C1(C)CCC(NC(=O)O)CC1 |
| InChI | InChI=1S/C14H24N2O2/c1-4-10-16(11-5-2)14(3)8-6-12(7-9-14)15-13(17)18/h4-5,12,15H,1-2,6-11H2,3H3,(H,17,18) |
| InChIKey | WSKNBHNUZHBXMR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|