C24H20N4O3 — CID 135308370
2-[1-[2-[4-(prop-2-enoylamino)phenyl]ethyl]pyrrolo[2,3-c]pyridin-5-yl]pyridine-4-carboxylic acid (PubChem CID 135308370) has the molecular formula C24H20N4O3 and a molecular weight of 412.45 g/mol. Its IUPAC name is 2-[1-[2-[4-(prop-2-enoylamino)phenyl]ethyl]pyrrolo[2,3-c]pyridin-5-yl]pyridine-4-carboxylic acid.
| Compound Name | 2-[1-[2-[4-(prop-2-enoylamino)phenyl]ethyl]pyrrolo[2,3-c]pyridin-5-yl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 135308370 |
| Molecular Formula | C24H20N4O3 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 2-[1-[2-[4-(prop-2-enoylamino)phenyl]ethyl]pyrrolo[2,3-c]pyridin-5-yl]pyridine-4-carboxylic acid |
| SMILES | C=CC(=O)Nc1ccc(CCn2ccc3cc(-c4cc(C(=O)O)ccn4)ncc32)cc1 |
| InChI | InChI=1S/C24H20N4O3/c1-2-23(29)27-19-5-3-16(4-6-19)8-11-28-12-9-17-13-21(26-15-22(17)28)20-14-18(24(30)31)7-10-25-20/h2-7,9-10,12-15H,1,8,11H2,(H,27,29)(H,30,31) |
| InChIKey | WFYWSEQHYNZNEE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|