C17H16BrNO3S — CID 135309885
4-bromo-N-(2-methylphenyl)sulfonyl-2,3-dihydro-1H-indene-1-carboxamide (PubChem CID 135309885) has the molecular formula C17H16BrNO3S and a molecular weight of 394.29 g/mol. Its IUPAC name is 4-bromo-N-(2-methylphenyl)sulfonyl-2,3-dihydro-1H-indene-1-carboxamide.
| Compound Name | 4-bromo-N-(2-methylphenyl)sulfonyl-2,3-dihydro-1H-indene-1-carboxamide |
|---|---|
| PubChem CID | 135309885 |
| Molecular Formula | C17H16BrNO3S |
| Molecular Weight | 394.29 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | 4-bromo-N-(2-methylphenyl)sulfonyl-2,3-dihydro-1H-indene-1-carboxamide |
| SMILES | Cc1ccccc1S(=O)(=O)NC(=O)C1CCc2c(Br)cccc21 |
| InChI | InChI=1S/C17H16BrNO3S/c1-11-5-2-3-8-16(11)23(21,22)19-17(20)14-10-9-13-12(14)6-4-7-15(13)18/h2-8,14H,9-10H2,1H3,(H,19,20) |
| InChIKey | FGCCIAQXMZVLSJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |