C18H19ClN2O4S — CID 135310096
N-(4-amino-2-chloro-5-methylphenyl)sulfonyl-4-methoxy-2,3-dihydro-1H-indene-1-carboxamide (PubChem CID 135310096) has the molecular formula C18H19ClN2O4S and a molecular weight of 394.88 g/mol. Its IUPAC name is N-(4-amino-2-chloro-5-methylphenyl)sulfonyl-4-methoxy-2,3-dihydro-1H-indene-1-carboxamide.
| Compound Name | N-(4-amino-2-chloro-5-methylphenyl)sulfonyl-4-methoxy-2,3-dihydro-1H-indene-1-carboxamide |
|---|---|
| PubChem CID | 135310096 |
| Molecular Formula | C18H19ClN2O4S |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | N-(4-amino-2-chloro-5-methylphenyl)sulfonyl-4-methoxy-2,3-dihydro-1H-indene-1-carboxamide |
| SMILES | COc1cccc2c1CCC2C(=O)NS(=O)(=O)c1cc(C)c(N)cc1Cl |
| InChI | InChI=1S/C18H19ClN2O4S/c1-10-8-17(14(19)9-15(10)20)26(23,24)21-18(22)13-7-6-12-11(13)4-3-5-16(12)25-2/h3-5,8-9,13H,6-7,20H2,1-2H3,(H,21,22) |
| InChIKey | TTXIQFWQPBAAMD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|