C18H19ClN4O5 — CID 135316524
(2R,3R,4S,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[5-chloro-2-(hydroxymethyl)phenyl]-hydroxymethyl]oxolane-3,4-diol (PubChem CID 135316524) has the molecular formula C18H19ClN4O5 and a molecular weight of 406.83 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[5-chloro-2-(hydroxymethyl)phenyl]-hydroxymethyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[5-chloro-2-(hydroxymethyl)phenyl]-hydroxymethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 135316524 |
| Molecular Formula | C18H19ClN4O5 |
| Molecular Weight | 406.83 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | (2R,3R,4S,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[5-chloro-2-(hydroxymethyl)phenyl]-hydroxymethyl]oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1ccn2[C@@H]1O[C@H](C(O)c2cc(Cl)ccc2CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H19ClN4O5/c19-9-2-1-8(6-24)11(5-9)12(25)15-13(26)14(27)18(28-15)23-4-3-10-16(20)21-7-22-17(10)23/h1-5,7,12-15,18,24-27H,6H2,(H2,20,21,22)/t12?,13-,14+,15+,18+/m0/s1 |
| InChIKey | IKPHUDYBTCYPEQ-JJSXZHHUSA-N |
| XLogP | 0.51 |
| TPSA | 146.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.83 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |