C17H17ClN4O2S — CID 135318312
(1S,2S,3R,5S)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-(4-chlorophenyl)sulfanylcyclopentane-1,2-diol (PubChem CID 135318312) has the molecular formula C17H17ClN4O2S and a molecular weight of 376.87 g/mol. Its IUPAC name is (1S,2S,3R,5S)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-(4-chlorophenyl)sulfanylcyclopentane-1,2-diol.
| Compound Name | (1S,2S,3R,5S)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-(4-chlorophenyl)sulfanylcyclopentane-1,2-diol |
|---|---|
| PubChem CID | 135318312 |
| Molecular Formula | C17H17ClN4O2S |
| Molecular Weight | 376.87 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | (1S,2S,3R,5S)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-(4-chlorophenyl)sulfanylcyclopentane-1,2-diol |
| SMILES | Nc1ncnc2c1ccn2[C@@H]1C[C@H](Sc2ccc(Cl)cc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H17ClN4O2S/c18-9-1-3-10(4-2-9)25-13-7-12(14(23)15(13)24)22-6-5-11-16(19)20-8-21-17(11)22/h1-6,8,12-15,23-24H,7H2,(H2,19,20,21)/t12-,13+,14+,15-/m1/s1 |
| InChIKey | MHLOCKTYXIORPC-CBBWQLFWSA-N |
| XLogP | 2.49 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.87 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |