C17H22N6O2 — CID 139449461
(1R,2S,3R,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[1-(3-methylimidazol-4-yl)ethyl]cyclopentane-1,2-diol (PubChem CID 139449461) has the molecular formula C17H22N6O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[1-(3-methylimidazol-4-yl)ethyl]cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[1-(3-methylimidazol-4-yl)ethyl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 139449461 |
| Molecular Formula | C17H22N6O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (1R,2S,3R,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[1-(3-methylimidazol-4-yl)ethyl]cyclopentane-1,2-diol |
| SMILES | CC(c1cncn1C)[C@H]1C[C@@H](n2ccc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H22N6O2/c1-9(13-6-19-8-22(13)2)11-5-12(15(25)14(11)24)23-4-3-10-16(18)20-7-21-17(10)23/h3-4,6-9,11-12,14-15,24-25H,5H2,1-2H3,(H2,18,20,21)/t9?,11-,12-,14-,15+/m1/s1 |
| InChIKey | UTQPZNMOHCDDEF-CZWUDEJYSA-N |
| XLogP | 0.83 |
| TPSA | 115.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |