About 1-phenylbut-3-yn-2-yl hypochlorite
1-phenylbut-3-yn-2-yl hypochlorite (PubChem CID 135318909) has the molecular formula C10H9ClO
and a molecular weight of 180.63 g/mol. Its IUPAC name is 1-phenylbut-3-yn-2-yl hypochlorite.
Molecular Properties
| Compound Name | 1-phenylbut-3-yn-2-yl hypochlorite |
| PubChem CID | 135318909 |
| Molecular Formula | C10H9ClO |
| Molecular Weight | 180.63 g/mol |
| Exact Mass | 180.03 |
| IUPAC Name | 1-phenylbut-3-yn-2-yl hypochlorite |
| SMILES | C#CC(Cc1ccccc1)OCl |
| InChI | InChI=1S/C10H9ClO/c1-2-10(12-11)8-9-6-4-3-5-7-9/h1,3-7,10H,8H2 |
| InChIKey | MVNMRMAJMWNTQT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.63 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylbut-3-yn-2-yl hypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylbut-3-yn-2-yl hypochlorite?
The IUPAC name of 1-phenylbut-3-yn-2-yl hypochlorite (CID 135318909) is 1-phenylbut-3-yn-2-yl hypochlorite.
What is the SMILES notation for 1-phenylbut-3-yn-2-yl hypochlorite?
The canonical SMILES for 1-phenylbut-3-yn-2-yl hypochlorite is C#CC(Cc1ccccc1)OCl.
What is the InChIKey of 1-phenylbut-3-yn-2-yl hypochlorite?
The InChIKey is MVNMRMAJMWNTQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClO/c1-2-10(12-11)8-9-6-4-3-5-7-9/h1,3-7,10H,8H2.
What are the key properties of 1-phenylbut-3-yn-2-yl hypochlorite?
1-phenylbut-3-yn-2-yl hypochlorite has a molecular weight of 180.63 g/mol, XLogP of 2.40, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylbut-3-yn-2-yl hypochlorite is sourced from PubChem (CID 135318909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).