C27H30FN3O — CID 135323099
N-[4-[[4-(6-fluoro-2-pyridinyl)-4-(2-phenylethyl)piperidin-1-yl]methyl]phenyl]acetamide (PubChem CID 135323099) has the molecular formula C27H30FN3O and a molecular weight of 431.56 g/mol. Its IUPAC name is N-[4-[[4-(6-fluoro-2-pyridinyl)-4-(2-phenylethyl)piperidin-1-yl]methyl]phenyl]acetamide.
| Compound Name | N-[4-[[4-(6-fluoro-2-pyridinyl)-4-(2-phenylethyl)piperidin-1-yl]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 135323099 |
| Molecular Formula | C27H30FN3O |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | N-[4-[[4-(6-fluoro-2-pyridinyl)-4-(2-phenylethyl)piperidin-1-yl]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CN2CCC(CCc3ccccc3)(c3cccc(F)n3)CC2)cc1 |
| InChI | InChI=1S/C27H30FN3O/c1-21(32)29-24-12-10-23(11-13-24)20-31-18-16-27(17-19-31,25-8-5-9-26(28)30-25)15-14-22-6-3-2-4-7-22/h2-13H,14-20H2,1H3,(H,29,32) |
| InChIKey | VUCLETVYBLJNHS-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|