C25H33N3OS — CID 135323114
1-[(1-benzylpyrazol-4-yl)methyl]-4-(ethoxymethyl)-4-(2-thiophen-2-ylethyl)piperidine (PubChem CID 135323114) has the molecular formula C25H33N3OS and a molecular weight of 423.63 g/mol. Its IUPAC name is 1-[(1-benzylpyrazol-4-yl)methyl]-4-(ethoxymethyl)-4-(2-thiophen-2-ylethyl)piperidine.
| Compound Name | 1-[(1-benzylpyrazol-4-yl)methyl]-4-(ethoxymethyl)-4-(2-thiophen-2-ylethyl)piperidine |
|---|---|
| PubChem CID | 135323114 |
| Molecular Formula | C25H33N3OS |
| Molecular Weight | 423.63 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | 1-[(1-benzylpyrazol-4-yl)methyl]-4-(ethoxymethyl)-4-(2-thiophen-2-ylethyl)piperidine |
| SMILES | CCOCC1(CCc2cccs2)CCN(Cc2cnn(Cc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C25H33N3OS/c1-2-29-21-25(11-10-24-9-6-16-30-24)12-14-27(15-13-25)18-23-17-26-28(20-23)19-22-7-4-3-5-8-22/h3-9,16-17,20H,2,10-15,18-19,21H2,1H3 |
| InChIKey | QIFUDZGTBYHMPG-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.63 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |