C20H31N3OS — CID 135323092
4-(ethoxymethyl)-1-[(1-ethylpyrazol-4-yl)methyl]-4-(2-thiophen-2-ylethyl)piperidine (PubChem CID 135323092) has the molecular formula C20H31N3OS and a molecular weight of 361.56 g/mol. Its IUPAC name is 4-(ethoxymethyl)-1-[(1-ethylpyrazol-4-yl)methyl]-4-(2-thiophen-2-ylethyl)piperidine.
| Compound Name | 4-(ethoxymethyl)-1-[(1-ethylpyrazol-4-yl)methyl]-4-(2-thiophen-2-ylethyl)piperidine |
|---|---|
| PubChem CID | 135323092 |
| Molecular Formula | C20H31N3OS |
| Molecular Weight | 361.56 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 4-(ethoxymethyl)-1-[(1-ethylpyrazol-4-yl)methyl]-4-(2-thiophen-2-ylethyl)piperidine |
| SMILES | CCOCC1(CCc2cccs2)CCN(Cc2cnn(CC)c2)CC1 |
| InChI | InChI=1S/C20H31N3OS/c1-3-23-16-18(14-21-23)15-22-11-9-20(10-12-22,17-24-4-2)8-7-19-6-5-13-25-19/h5-6,13-14,16H,3-4,7-12,15,17H2,1-2H3 |
| InChIKey | SEWRXKZPTSKXOJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.56 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |