C10H21N3O4 — CID 135324641
[1-amino-5-(carboxyamino)-6-methylheptan-2-yl]carbamic acid (PubChem CID 135324641) has the molecular formula C10H21N3O4 and a molecular weight of 247.29 g/mol. Its IUPAC name is [1-amino-5-(carboxyamino)-6-methylheptan-2-yl]carbamic acid.
| Compound Name | [1-amino-5-(carboxyamino)-6-methylheptan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 135324641 |
| Molecular Formula | C10H21N3O4 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | [1-amino-5-(carboxyamino)-6-methylheptan-2-yl]carbamic acid |
| SMILES | CC(C)C(CCC(CN)NC(=O)O)NC(=O)O |
| InChI | InChI=1S/C10H21N3O4/c1-6(2)8(13-10(16)17)4-3-7(5-11)12-9(14)15/h6-8,12-13H,3-5,11H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | ILVPNUSYAMTYFH-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |