C20H17FN6O2 — CID 135329551
N-[4-fluoro-3-[[2-(pyridin-3-ylamino)-1H-pyrrolo[2,1-f][1,2,4]triazin-2-yl]oxy]phenyl]prop-2-enamide (PubChem CID 135329551) has the molecular formula C20H17FN6O2 and a molecular weight of 392.39 g/mol. Its IUPAC name is N-[4-fluoro-3-[[2-(pyridin-3-ylamino)-1H-pyrrolo[2,1-f][1,2,4]triazin-2-yl]oxy]phenyl]prop-2-enamide.
| Compound Name | N-[4-fluoro-3-[[2-(pyridin-3-ylamino)-1H-pyrrolo[2,1-f][1,2,4]triazin-2-yl]oxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 135329551 |
| Molecular Formula | C20H17FN6O2 |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | N-[4-fluoro-3-[[2-(pyridin-3-ylamino)-1H-pyrrolo[2,1-f][1,2,4]triazin-2-yl]oxy]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(F)c(OC2(Nc3cccnc3)N=Cc3cccn3N2)c1 |
| InChI | InChI=1S/C20H17FN6O2/c1-2-19(28)24-14-7-8-17(21)18(11-14)29-20(25-15-5-3-9-22-12-15)23-13-16-6-4-10-27(16)26-20/h2-13,25-26H,1H2,(H,24,28) |
| InChIKey | VKIYCSOQZVDSMZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|