C16H12Cl2FN5O — CID 135329848
1-[5-(2-amino-1H-imidazol-5-yl)-2-fluorophenyl]-3-(3,4-dichlorophenyl)urea (PubChem CID 135329848) has the molecular formula C16H12Cl2FN5O and a molecular weight of 380.21 g/mol. Its IUPAC name is 1-[5-(2-amino-1H-imidazol-5-yl)-2-fluorophenyl]-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-[5-(2-amino-1H-imidazol-5-yl)-2-fluorophenyl]-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 135329848 |
| Molecular Formula | C16H12Cl2FN5O |
| Molecular Weight | 380.21 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | 1-[5-(2-amino-1H-imidazol-5-yl)-2-fluorophenyl]-3-(3,4-dichlorophenyl)urea |
| SMILES | Nc1ncc(-c2ccc(F)c(NC(=O)Nc3ccc(Cl)c(Cl)c3)c2)[nH]1 |
| InChI | InChI=1S/C16H12Cl2FN5O/c17-10-3-2-9(6-11(10)18)22-16(25)24-13-5-8(1-4-12(13)19)14-7-21-15(20)23-14/h1-7H,(H3,20,21,23)(H2,22,24,25) |
| InChIKey | AGPHARPOUKAEOG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.21 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |