C25H18F3NO4 — CID 135331037
2-[3-[4-(1-methylisoquinolin-8-yl)oxy-2-(trifluoromethyl)phenoxy]phenyl]acetic acid (PubChem CID 135331037) has the molecular formula C25H18F3NO4 and a molecular weight of 453.42 g/mol. Its IUPAC name is 2-[3-[4-(1-methylisoquinolin-8-yl)oxy-2-(trifluoromethyl)phenoxy]phenyl]acetic acid.
| Compound Name | 2-[3-[4-(1-methylisoquinolin-8-yl)oxy-2-(trifluoromethyl)phenoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 135331037 |
| Molecular Formula | C25H18F3NO4 |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 2-[3-[4-(1-methylisoquinolin-8-yl)oxy-2-(trifluoromethyl)phenoxy]phenyl]acetic acid |
| SMILES | Cc1nccc2cccc(Oc3ccc(Oc4cccc(CC(=O)O)c4)c(C(F)(F)F)c3)c12 |
| InChI | InChI=1S/C25H18F3NO4/c1-15-24-17(10-11-29-15)5-3-7-22(24)33-19-8-9-21(20(14-19)25(26,27)28)32-18-6-2-4-16(12-18)13-23(30)31/h2-12,14H,13H2,1H3,(H,30,31) |
| InChIKey | AKVLNZGPZMRENW-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |