C24H22F3N5O2 — CID 161270786
N'-amino-2-[3-[4-isoquinolin-8-yloxy-2-(trifluoromethyl)phenoxy]phenyl]ethanimidamide;azane (PubChem CID 161270786) has the molecular formula C24H22F3N5O2 and a molecular weight of 469.47 g/mol. Its IUPAC name is N'-amino-2-[3-[4-isoquinolin-8-yloxy-2-(trifluoromethyl)phenoxy]phenyl]ethanimidamide;azane.
| Compound Name | N'-amino-2-[3-[4-isoquinolin-8-yloxy-2-(trifluoromethyl)phenoxy]phenyl]ethanimidamide;azane |
|---|---|
| PubChem CID | 161270786 |
| Molecular Formula | C24H22F3N5O2 |
| Molecular Weight | 469.47 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | N'-amino-2-[3-[4-isoquinolin-8-yloxy-2-(trifluoromethyl)phenoxy]phenyl]ethanimidamide;azane |
| SMILES | N.NN=C(N)Cc1cccc(Oc2ccc(Oc3cccc4ccncc34)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C24H19F3N4O2.H3N/c25-24(26,27)20-13-18(32-21-6-2-4-16-9-10-30-14-19(16)21)7-8-22(20)33-17-5-1-3-15(11-17)12-23(28)31-29;/h1-11,13-14H,12,29H2,(H2,28,31);1H3 |
| InChIKey | ITGFJIVZJMLOHT-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.47 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|