C22H17F6N3OS — CID 143485435
N'-amino-2-[3-[4-phenylsulfanyl-2-(trifluoromethyl)phenoxy]-5-(trifluoromethyl)phenyl]ethanimidamide (PubChem CID 143485435) has the molecular formula C22H17F6N3OS and a molecular weight of 485.45 g/mol. Its IUPAC name is N'-amino-2-[3-[4-phenylsulfanyl-2-(trifluoromethyl)phenoxy]-5-(trifluoromethyl)phenyl]ethanimidamide.
| Compound Name | N'-amino-2-[3-[4-phenylsulfanyl-2-(trifluoromethyl)phenoxy]-5-(trifluoromethyl)phenyl]ethanimidamide |
|---|---|
| PubChem CID | 143485435 |
| Molecular Formula | C22H17F6N3OS |
| Molecular Weight | 485.45 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | N'-amino-2-[3-[4-phenylsulfanyl-2-(trifluoromethyl)phenoxy]-5-(trifluoromethyl)phenyl]ethanimidamide |
| SMILES | N/N=C(\N)Cc1cc(Oc2ccc(Sc3ccccc3)cc2C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H17F6N3OS/c23-21(24,25)14-8-13(10-20(29)31-30)9-15(11-14)32-19-7-6-17(12-18(19)22(26,27)28)33-16-4-2-1-3-5-16/h1-9,11-12H,10,30H2,(H2,29,31) |
| InChIKey | QLYLAILVUFTGLE-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.45 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|