C17H15F6N3O3S — CID 143485437
N'-amino-2-[3-[4-methylsulfonyl-3-(trifluoromethyl)phenoxy]-5-(trifluoromethyl)phenyl]ethanimidamide (PubChem CID 143485437) has the molecular formula C17H15F6N3O3S and a molecular weight of 455.38 g/mol. Its IUPAC name is N'-amino-2-[3-[4-methylsulfonyl-3-(trifluoromethyl)phenoxy]-5-(trifluoromethyl)phenyl]ethanimidamide.
| Compound Name | N'-amino-2-[3-[4-methylsulfonyl-3-(trifluoromethyl)phenoxy]-5-(trifluoromethyl)phenyl]ethanimidamide |
|---|---|
| PubChem CID | 143485437 |
| Molecular Formula | C17H15F6N3O3S |
| Molecular Weight | 455.38 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | N'-amino-2-[3-[4-methylsulfonyl-3-(trifluoromethyl)phenoxy]-5-(trifluoromethyl)phenyl]ethanimidamide |
| SMILES | CS(=O)(=O)c1ccc(Oc2cc(C/C(N)=N/N)cc(C(F)(F)F)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C17H15F6N3O3S/c1-30(27,28)14-3-2-11(8-13(14)17(21,22)23)29-12-5-9(6-15(24)26-25)4-10(7-12)16(18,19)20/h2-5,7-8H,6,25H2,1H3,(H2,24,26) |
| InChIKey | PGWZRVQAVCWWQF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|