C22H15F5O4S — CID 148885646
3-[3-[2-fluoro-4-(4-fluorophenyl)sulfonylphenoxy]-5-(trifluoromethyl)phenyl]prop-1-en-2-ol (PubChem CID 148885646) has the molecular formula C22H15F5O4S and a molecular weight of 470.42 g/mol. Its IUPAC name is 3-[3-[2-fluoro-4-(4-fluorophenyl)sulfonylphenoxy]-5-(trifluoromethyl)phenyl]prop-1-en-2-ol.
| Compound Name | 3-[3-[2-fluoro-4-(4-fluorophenyl)sulfonylphenoxy]-5-(trifluoromethyl)phenyl]prop-1-en-2-ol |
|---|---|
| PubChem CID | 148885646 |
| Molecular Formula | C22H15F5O4S |
| Molecular Weight | 470.42 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | 3-[3-[2-fluoro-4-(4-fluorophenyl)sulfonylphenoxy]-5-(trifluoromethyl)phenyl]prop-1-en-2-ol |
| SMILES | C=C(O)Cc1cc(Oc2ccc(S(=O)(=O)c3ccc(F)cc3)cc2F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H15F5O4S/c1-13(28)8-14-9-15(22(25,26)27)11-17(10-14)31-21-7-6-19(12-20(21)24)32(29,30)18-4-2-16(23)3-5-18/h2-7,9-12,28H,1,8H2 |
| InChIKey | PDXSZAJTUXVPMM-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.42 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|